trans-2-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, 98%
cas: 209128-50-7 — see every product listed under this CAS number, including other names
trans-2-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, 98% (CAS 209128-50-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A143036-250mg |
| cas | 209128-50-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 470.50 Pln | |
| Ambeed | 5g | 1638.62 Pln | |
| Ambeed | 10g | 2995.88 Pln | |
| Ambeed | 25g | 5554.62 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 957.20 Pln | |
| Chemat | 10g | 1715.60 Pln | |
| Chemat | 25g | 3400.40 Pln | |
| BLDpharm | 100mg | 192.18 Pln | |
| BLDpharm | 250mg | 281.04 Pln | |
| BLDpharm | 1g | 503.18 Pln | |
| BLDpharm | 5g | 1758.29 Pln | |
| BLDpharm | 10g | 2946.76 Pln | |
| BLDpharm | 25g | 5979.03 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 209128-50-7) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: QJEQJDJFJWWURK-RKDXNWHRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | QJEQJDJFJWWURK-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(1R,2R)-2-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylic acid, rac-(1R,2R)-2-(((tert-butoxy)carbonyl)amino)cyclohexane-1-carboxylic acid, rac-(1R,2R)-2-{[(tert-butoxy)carbonyl]amino}cyclohexane-1-carboxylic acid, trans-2-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, Boc-1,2-trans-ACHC-OH, (1R,2R)-2-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, (1R,2R)-Boc-aminocyclohexane carboxylic acid, (1R,2R)-2-tert-Butoxycarbonylamino-cyclohexanecarboxylic acid, (1R,2R)-Boc-2-aminocyclohexane carboxylic acid, (1R,2R)-2-{[(tert-butoxy)carbonyl]amino}cyclohexane-1-carboxylic acid