cas: 1212381-16-2 — see every product listed under this CAS number, including other names
trans-2-((tert-Butoxycarbonyl)amino)cyclopropanecarboxylic acid 97% (CAS 1212381-16-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A228415-100mg |
| cas | 1212381-16-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 731.94 Pln | |
| Ambeed | 250mg | 1165.81 Pln | |
| Ambeed | 1g | 2962.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A228415 |
Trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid (CAS 1212381-16-2) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid. InChIKey: NOZMNADEEKQWGO-PHDIDXHHSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid |
| InChIKey | NOZMNADEEKQWGO-PHDIDXHHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H]1C(=O)O |
Computed by PubChem (NCBI)