cas: 1212381-16-2 — see every product listed under this CAS number, including other names
(1R,2R)-2-((TERT-BUTOXYCARBONYL)AMINO)CYCLOPROPANECARBOXYLIC ACID, 98% (CAS 1212381-16-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F330901-25MG |
| cas | 1212381-16-2 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 549.82 Pln | |
| Fluorochem | 100mg | 690.40 Pln | |
| Fluorochem | 250mg | 1106.92 Pln | |
| Fluorochem | 500mg | 2101.36 Pln | |
| Fluorochem | 1g | 2892.75 Pln | |
| Fluorochem | 5g | 12378.99 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid (CAS 1212381-16-2) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid. InChIKey: NOZMNADEEKQWGO-PHDIDXHHSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid |
| InChIKey | NOZMNADEEKQWGO-PHDIDXHHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H]1C(=O)O |
Computed by PubChem (NCBI)