cas: 15573-40-7 — see every product listed under this CAS number, including other names
trans-4-Cyclohexene-1,2-dicarboxylic acid 95% (CAS 15573-40-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A145223-100mg |
| cas | 15573-40-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A145223 |
(1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid (CAS 15573-40-7) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: (1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid. InChIKey: ILUAAIDVFMVTAU-PHDIDXHHSA-N.
| Molecular formula | C8H10O4 |
|---|---|
| Molecular weight | 170.16 g/mol |
| IUPAC name | (1R,2R)-cyclohex-4-ene-1,2-dicarboxylic acid |
| InChIKey | ILUAAIDVFMVTAU-PHDIDXHHSA-N |
| SMILES | C1C=CC[C@H]([C@@H]1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)