cas: 21156-44-5 — see every product listed under this CAS number, including other names
trans-4-Fluoropyrrolidine-2-carboxylic acid, 97% (CAS 21156-44-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A366233-250mg |
| cas | 21156-44-5 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 1743.07 Pln | |
| AmBeed | 1g | 4262.44 Pln | |
| AmBeed | 100mg | 1339.45 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S,4R)-4-fluoropyrrolidine-2-carboxylic acid (CAS 21156-44-5) is a chemical compound with the molecular formula C5H8FNO2 and a molecular weight of 133.12 g/mol. IUPAC name: (2S,4R)-4-fluoropyrrolidine-2-carboxylic acid. InChIKey: ZIWHMENIDGOELV-DMTCNVIQSA-N.
| Molecular formula | C5H8FNO2 |
|---|---|
| Molecular weight | 133.12 g/mol |
| IUPAC name | (2S,4R)-4-fluoropyrrolidine-2-carboxylic acid |
| InChIKey | ZIWHMENIDGOELV-DMTCNVIQSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)F |
Computed by PubChem (NCBI)