cas: 85995-53-5 — see every product listed under this CAS number, including other names
((Benzyloxy)carbonyl)-L-allothreonine, 98%, 98% (CAS 85995-53-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 250mg, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115VN9-100mg |
| cas | 85995-53-5 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 352.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 10g | 611.60 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 50g | 2061.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 85995-53-5) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: IPJUIRDNBFZGQN-WPRPVWTQSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | IPJUIRDNBFZGQN-WPRPVWTQSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)