CAS 119221-16-8 appears in our catalog under these names: ((Benzyloxy)carbonyl)-D-allothreonine, 95%, 95%, ((Benzyloxy)carbonyl)-D-allothreonine, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 500mg, 5g, 10g.
(2R,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 119221-16-8) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: (2R,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: IPJUIRDNBFZGQN-PSASIEDQSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | (2R,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | IPJUIRDNBFZGQN-PSASIEDQSA-N |
| SMILES | C[C@H]([C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)