CAS 80384-27-6 appears in our catalog under these names: Z–D–Thr–OH, N-Carbobenzoxy-D-threonine, >98.0%(HPLC)(T), (2R,3S)-2-(((Benzyloxy)carbonyl)amino)-3-hydroxybutanoic acid, 98%, 98%, Z-D-Thr-OH, 99.77%, Z-D-Thr-OH, 98%. Offered by: GLPBio, TCI, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 250mg, 10g, 50g, 25 g.
(2R,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 80384-27-6) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: (2R,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: IPJUIRDNBFZGQN-WCBMZHEXSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | (2R,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | IPJUIRDNBFZGQN-WCBMZHEXSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)