CAS 85995-53-5 appears in our catalog under these names: (2S,3S)-2-(((Benzyloxy)carbonyl)amino)-3-hydroxybutanoic acid, 98%, ((Benzyloxy)carbonyl)–L–allothreonine, ((Benzyloxy)carbonyl)-L-allothreonine, 98%, 98%, ((Benzyloxy)carbonyl)-L-allothreonine, 98%, Cbz-Allo-Thr-OH, 95%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g, 25g, 50g.
(2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 85995-53-5) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: IPJUIRDNBFZGQN-WPRPVWTQSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | (2S,3S)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | IPJUIRDNBFZGQN-WPRPVWTQSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)