cas: 38235-77-7 — see every product listed under this CAS number, including other names
(R)-(+)-N-Benzyl-1-phenylethylamine, 97%, 97% (CAS 38235-77-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 250g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143E8-5g |
| cas | 38235-77-7 |
| size | 5g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 250g | 285.20 Pln | |
| Chemat | 500g | 523.20 Pln | |
| Chemat | 1kg | 962.00 Pln | |
| Chemat | 5kg | 4248.00 Pln | |
| Chemat | 10kg | price on request |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1R)-N-benzyl-1-phenylethanamine (CAS 38235-77-7) is a chemical compound with the molecular formula C15H17N and a molecular weight of 211.30 g/mol. IUPAC name: (1R)-N-benzyl-1-phenylethanamine. InChIKey: ZYZHMSJNPCYUTB-CYBMUJFWSA-N.
| Molecular formula | C15H17N |
|---|---|
| Molecular weight | 211.30 g/mol |
| IUPAC name | (1R)-N-benzyl-1-phenylethanamine |
| InChIKey | ZYZHMSJNPCYUTB-CYBMUJFWSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NCC2=CC=CC=C2 |
Computed by PubChem (NCBI)