cas: 608-68-4 — see every product listed under this CAS number, including other names
Dimethyl (2R,3R)-2,3-dihydroxysuccinate 97% (CAS 608-68-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A694721-5g |
| cas | 608-68-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 309.19 Pln | |
| Ambeed | 500g | 1165.81 Pln | |
| Ambeed | 1000g | 2250.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A694721 |
Dimethyl (2R,3R)-2,3-dihydroxybutanedioate (CAS 608-68-4) is a chemical compound with the molecular formula C6H10O6 and a molecular weight of 178.14 g/mol. IUPAC name: dimethyl (2R,3R)-2,3-dihydroxybutanedioate. InChIKey: PVRATXCXJDHJJN-QWWZWVQMSA-N.
| Molecular formula | C6H10O6 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | dimethyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChIKey | PVRATXCXJDHJJN-QWWZWVQMSA-N |
| SMILES | COC(=O)[C@@H]([C@H](C(=O)OC)O)O |
Computed by PubChem (NCBI)