cas: 20445-31-2 — see every product listed under this CAS number, including other names
(+)-a-Methoxy-a-(trifluoromethyl)phenylacetic acid (CAS 20445-31-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009273-250MG |
| cas | 20445-31-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 508.17 Pln | |
| Fluorochem | 5g | 1731.70 Pln |
| delivery time | 3-4 weeks |
|---|
(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid (CAS 20445-31-2) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid. InChIKey: JJYKJUXBWFATTE-SECBINFHSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid |
| InChIKey | JJYKJUXBWFATTE-SECBINFHSA-N |
| SMILES | CO[C@](C1=CC=CC=C1)(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)