cas: 20445-31-2 — see every product listed under this CAS number, including other names
(R)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid 97% (CAS 20445-31-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A600761-100g |
| cas | 20445-31-2 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 16952.19 Pln | |
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 392.62 Pln | |
| Ambeed | 5g | 1571.88 Pln | |
| Ambeed | 25g | 5343.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A600761 |
(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid (CAS 20445-31-2) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid. InChIKey: JJYKJUXBWFATTE-SECBINFHSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid |
| InChIKey | JJYKJUXBWFATTE-SECBINFHSA-N |
| SMILES | CO[C@](C1=CC=CC=C1)(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)