CAS 22976-70-1 appears in our catalog under these names: (+/-)-4-Carboxylic acid phenylalanine, 95%, 4–(2–Amino–2–carboxyethyl)benzoic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-(2-amino-2-carboxyethyl)benzoic acid (CAS 22976-70-1) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 4-(2-amino-2-carboxyethyl)benzoic acid. InChIKey: YXDGRBPZVQPESQ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 4-(2-amino-2-carboxyethyl)benzoic acid |
| InChIKey | YXDGRBPZVQPESQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)