CAS 135046-48-9 appears in our catalog under these names: (+/-)-Clopidogrel bisulfate, 98%, rac-Clopidogrel Hydrogen Sulfate, >95% (HPLC), (±) Clopidogrel hydrogen sulfate/ 99.62% (existing batch purity), (±)–Clopidogrel bisulfate, Clopidogrel bisulfate. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 25mg, 500mg, 200mg, 10mg.
Methyl 2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid (CAS 135046-48-9) is a chemical compound with the molecular formula C16H18ClNO6S2 and a molecular weight of 419.9 g/mol. IUPAC name: methyl 2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid. InChIKey: FDEODCTUSIWGLK-UHFFFAOYSA-N.
| Molecular formula | C16H18ClNO6S2 |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | methyl 2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;sulfuric acid |
| InChIKey | FDEODCTUSIWGLK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=CC=C1Cl)N2CCC3=C(C2)C=CS3.OS(=O)(=O)O |
Computed by PubChem (NCBI)