CAS 227619-64-9 appears in our catalog under these names: (+/-)-HIP-A, (±)–HIP–A, (±)-HIP-A. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 10mg, Get quote.
3-oxo-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,2]oxazole-4-carboxylic acid (CAS 227619-64-9) is a chemical compound with the molecular formula C6H8N2O4 and a molecular weight of 172.14 g/mol. IUPAC name: 3-oxo-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,2]oxazole-4-carboxylic acid. InChIKey: XJSXFNHFIBCTDU-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O4 |
|---|---|
| Molecular weight | 172.14 g/mol |
| IUPAC name | 3-oxo-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,2]oxazole-4-carboxylic acid |
| InChIKey | XJSXFNHFIBCTDU-UHFFFAOYSA-N |
| SMILES | C1C2C(C(N1)C(=O)O)C(=O)NO2 |
Computed by PubChem (NCBI)