CAS 1392213-98-7 is the registry number for (+/-)-Trans-4-(3-hydroxy-phenyl)-pyrrolidine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
(3R,4S)-4-(3-hydroxyphenyl)pyrrolidine-3-carboxylic acid;hydrochloride (CAS 1392213-98-7) is a chemical compound with the molecular formula C11H14ClNO3 and a molecular weight of 243.68 g/mol. IUPAC name: (3R,4S)-4-(3-hydroxyphenyl)pyrrolidine-3-carboxylic acid;hydrochloride. InChIKey: WLPLXUBRPZXXLL-UXQCFNEQSA-N.
| Molecular formula | C11H14ClNO3 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | (3R,4S)-4-(3-hydroxyphenyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| InChIKey | WLPLXUBRPZXXLL-UXQCFNEQSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=CC(=CC=C2)O.Cl |
Computed by PubChem (NCBI)