CAS 81655-41-6 appears in our catalog under these names: (+/-)-Alpha-methoxy-alpha-trifluoromethylphenylacetic acid, 98%, 3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic acid, (+/-)-a-Methoxy-a-trifluoromethylphenylacetic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid (CAS 81655-41-6) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: 3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid. InChIKey: JJYKJUXBWFATTE-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid |
| InChIKey | JJYKJUXBWFATTE-UHFFFAOYSA-N |
| SMILES | COC(C1=CC=CC=C1)(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)