cas: 371770-32-0 — see every product listed under this CAS number, including other names
(αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclopentanepropanoic acid, 97%, 97% (CAS 371770-32-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C8ZR-50mg |
| cas | 371770-32-0 |
| size | 50mg |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 78.80 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 500mg | 150.80 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 818.00 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 3026.00 Pln | |
| Chemat | 50g | 5853.20 Pln | |
| Chemat | 250g | 16298.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 371770-32-0) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: (2S)-3-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: NVZVRXJTMCMDNR-NRFANRHFSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2S)-3-cyclopentyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | NVZVRXJTMCMDNR-NRFANRHFSA-N |
| SMILES | C1CCC(C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)