(-)-Corey lactone benzoate, 97%
cas: 39746-00-4 — see every product listed under this CAS number, including other names
(-)-Corey lactone benzoate, 97% (CAS 39746-00-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 100mg, 10g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A169100-250mg |
| cas | 39746-00-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 654.06 Pln | |
| Ambeed | 25g | 2000.19 Pln | |
| Ambeed | 100g | 6249.94 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 621.20 Pln | |
| Chemat | 25g | 1317.20 Pln | |
| Chemat | 100g | 3952.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[(3aR,4S,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (CAS 39746-00-4) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: [(3aR,4S,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate. InChIKey: OBRRYUZUDKVCOO-FVCCEPFGSA-N.
| Molecular formula | C15H16O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | [(3aR,4S,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| InChIKey | OBRRYUZUDKVCOO-FVCCEPFGSA-N |
| SMILES | C1[C@H]2[C@H](CC(=O)O2)[C@H]([C@@H]1OC(=O)C3=CC=CC=C3)CO |
Computed by PubChem (NCBI)