Products 39746-00-4
CAS 39746-00-4 appears in our catalog under these names: Travoprost Impurity 31, (-)-Corey Lactone Benzoate, (–)–Corey lactone benzoate, (-)-Corey Lactone Benzoate, >98.0%(HPLC)(qNMR), (-)-Corey lactone benzoate, 500 mg. Offered by: Chemat Brand, TRC, GLPBio, TCI, Biosynth. Available pack sizes: on request, 1g, 25g, 5g, 200mg, 1000mg, 500mg, 2000mg.
[(3aR,4S,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (CAS 39746-00-4) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: [(3aR,4S,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate. InChIKey: OBRRYUZUDKVCOO-FVCCEPFGSA-N.
| Molecular formula | C15H16O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | [(3aR,4S,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| InChIKey | OBRRYUZUDKVCOO-FVCCEPFGSA-N |
| SMILES | C1[C@H]2[C@H](CC(=O)O2)[C@H]([C@@H]1OC(=O)C3=CC=CC=C3)CO |
Computed by PubChem (NCBI)