CAS 2218532-66-0 is the registry number for Travoprost Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
[(3aR,4R,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (CAS 2218532-66-0) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: [(3aR,4R,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate. InChIKey: OBRRYUZUDKVCOO-MROQNXINSA-N.
| Molecular formula | C15H16O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | [(3aR,4R,5R,6aS)-4-(hydroxymethyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| InChIKey | OBRRYUZUDKVCOO-MROQNXINSA-N |
| SMILES | C1[C@H]2[C@H](CC(=O)O2)[C@@H]([C@@H]1OC(=O)C3=CC=CC=C3)CO |
Computed by PubChem (NCBI)