cas: 40248-63-3 — see every product listed under this CAS number, including other names
(-)-Menthoxyacetic Acid, >97.0%(GC)(T) (CAS 40248-63-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M0573-5G |
| cas | 40248-63-3 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 506.81 Pln | |
| TCI | 25g | 2104.91 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC)(T) |
2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid (CAS 40248-63-3) is a chemical compound with the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. IUPAC name: 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid. InChIKey: CILPHQCEVYJUDN-UHFFFAOYSA-N.
| Molecular formula | C12H22O3 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid |
| InChIKey | CILPHQCEVYJUDN-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(C1)OCC(=O)O)C(C)C |
Computed by PubChem (NCBI)