cas: 40248-63-3 — see every product listed under this CAS number, including other names
(-)-Menthyloxyacetic acid, 97.0% (CAS 40248-63-3) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W093149-1 g |
| cas | 40248-63-3 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 263.96 Pln | |
| MedChemExpress | 5 g | 505.45 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid (CAS 40248-63-3) is a chemical compound with the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. IUPAC name: 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid. InChIKey: CILPHQCEVYJUDN-UHFFFAOYSA-N.
| Molecular formula | C12H22O3 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | 2-(5-methyl-2-propan-2-ylcyclohexyl)oxyacetic acid |
| InChIKey | CILPHQCEVYJUDN-UHFFFAOYSA-N |
| SMILES | CC1CCC(C(C1)OCC(=O)O)C(C)C |
Computed by PubChem (NCBI)