cas: 17257-71-5 — see every product listed under this CAS number, including other names
(-)-a-Methoxy-a-(trifluoromethyl)phenylacetic acid, 98% (CAS 17257-71-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009274-100MG |
| cas | 17257-71-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 500mg | 419.66 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1794.18 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid (CAS 17257-71-5) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid. InChIKey: JJYKJUXBWFATTE-VIFPVBQESA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid |
| InChIKey | JJYKJUXBWFATTE-VIFPVBQESA-N |
| SMILES | CO[C@@](C1=CC=CC=C1)(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)