cas: 17257-71-5 — see every product listed under this CAS number, including other names
(S)-3,3,3-Trifluoro-2-methoxy-2-phenylpropanoic Acid, 97%, 97% (CAS 17257-71-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZL1-100mg |
| cas | 17257-71-5 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 482.00 Pln | |
| Chemat | 5g | 1955.60 Pln | |
| Chemat | 10g | 3784.40 Pln | |
| Chemat | 25g | 6515.60 Pln | |
| Chemat | 50g | 7437.20 Pln | |
| Chemat | 100g | 14085.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid (CAS 17257-71-5) is a chemical compound with the molecular formula C10H9F3O3 and a molecular weight of 234.17 g/mol. IUPAC name: (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid. InChIKey: JJYKJUXBWFATTE-VIFPVBQESA-N.
| Molecular formula | C10H9F3O3 |
|---|---|
| Molecular weight | 234.17 g/mol |
| IUPAC name | (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid |
| InChIKey | JJYKJUXBWFATTE-VIFPVBQESA-N |
| SMILES | CO[C@@](C1=CC=CC=C1)(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)