cas: 32604-29-8 — see every product listed under this CAS number, including other names
(1,1'-Biphenyl)-4,4'-diyl diacetate, 99% (CAS 32604-29-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A405863-1g |
| cas | 32604-29-8 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 154.63 Pln | |
| AmBeed | 5g | 271.81 Pln |
| purity | 99% |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-(4-acetyloxyphenyl)phenyl] acetate (CAS 32604-29-8) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: [4-(4-acetyloxyphenyl)phenyl] acetate. InChIKey: RQMBBMQDXFZFCC-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | [4-(4-acetyloxyphenyl)phenyl] acetate |
| InChIKey | RQMBBMQDXFZFCC-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C2=CC=C(C=C2)OC(=O)C |
Computed by PubChem (NCBI)