cas: 32604-29-8 — see every product listed under this CAS number, including other names
[1,1'-Biphenyl]-4,4'-diyl diacetate (CAS 32604-29-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114KEL-1g |
| cas | 32604-29-8 |
| size | 1g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 25g | 189.20 Pln | |
| Chemat | 100g | 424.40 Pln | |
| Chemat | 500g | 1876.80 Pln |
| delivery time | 3 weeks |
|---|
[4-(4-acetyloxyphenyl)phenyl] acetate (CAS 32604-29-8) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: [4-(4-acetyloxyphenyl)phenyl] acetate. InChIKey: RQMBBMQDXFZFCC-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | [4-(4-acetyloxyphenyl)phenyl] acetate |
| InChIKey | RQMBBMQDXFZFCC-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C2=CC=C(C=C2)OC(=O)C |
Computed by PubChem (NCBI)