cas: 1228183-22-9 — see every product listed under this CAS number, including other names
(1H-Benzo[d]imidazol-5-yl)boronic acid 98% (CAS 1228183-22-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A860814-100mg |
| cas | 1228183-22-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1327.12 Pln | |
| Ambeed | 5g | 4520.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A860814 |
3H-benzimidazol-5-ylboronic acid (CAS 1228183-22-9) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: 3H-benzimidazol-5-ylboronic acid. InChIKey: PJLWYAFHMUXYCI-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | 3H-benzimidazol-5-ylboronic acid |
| InChIKey | PJLWYAFHMUXYCI-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N=CN2)(O)O |
Computed by PubChem (NCBI)