Products 915411-01-7
CAS 915411-01-7 appears in our catalog under these names: 1H-Indazol-7-ylboronic acid, 97%, (1H-Indazol-7-yl)boronic acid, 1H-INDAZOLE-7-BORONIC ACID, 98%, (1H-Indazol-7-yl)boronic acid 98%, (1H-Indazol-7-yl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Fluorochem, Ambeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 2,5g, 100mg.
1H-indazol-7-ylboronic acid (CAS 915411-01-7) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: 1H-indazol-7-ylboronic acid. InChIKey: QAHHYPPRKWNXHT-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | 1H-indazol-7-ylboronic acid |
| InChIKey | QAHHYPPRKWNXHT-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C=NN2)(O)O |
Computed by PubChem (NCBI)