cas: 915411-01-7 — see every product listed under this CAS number, including other names
(1H-Indazol-7-yl)boronic acid, 98%, 98% (CAS 915411-01-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11707K-100mg |
| cas | 915411-01-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 530.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1H-indazol-7-ylboronic acid (CAS 915411-01-7) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: 1H-indazol-7-ylboronic acid. InChIKey: QAHHYPPRKWNXHT-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | 1H-indazol-7-ylboronic acid |
| InChIKey | QAHHYPPRKWNXHT-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)C=NN2)(O)O |
Computed by PubChem (NCBI)