cas: 944059-24-9 — see every product listed under this CAS number, including other names
(1H-Pyrrolo[2,3-b]pyridin-5-yl)boronic acid, 97% (CAS 944059-24-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F236668-100MG |
| cas | 944059-24-9 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 148.92 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 500mg | 336.36 Pln | |
| Fluorochem | 1g | 357.18 Pln | |
| Fluorochem | 5g | 992.38 Pln | |
| Fluorochem | 10g | 1872.28 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 348.12 Pln | |
| Ambeed | 5g | 971.12 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1H-pyrrolo[2,3-b]pyridin-5-ylboronic acid (CAS 944059-24-9) is a chemical compound with the molecular formula C7H7BN2O2 and a molecular weight of 161.96 g/mol. IUPAC name: 1H-pyrrolo[2,3-b]pyridin-5-ylboronic acid. InChIKey: KCHKRCSVKZQYCA-UHFFFAOYSA-N.
| Molecular formula | C7H7BN2O2 |
|---|---|
| Molecular weight | 161.96 g/mol |
| IUPAC name | 1H-pyrrolo[2,3-b]pyridin-5-ylboronic acid |
| InChIKey | KCHKRCSVKZQYCA-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(NC=C2)N=C1)(O)O |
Computed by PubChem (NCBI)