cas: 1820570-24-8 — see every product listed under this CAS number, including other names
(1R)-1-(3-Fluoro-4-methylphenyl)ethan-1-amine hydrochloride, 95+%, 95+% (CAS 1820570-24-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ASB5-100mg |
| cas | 1820570-24-8 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 995.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride (CAS 1820570-24-8) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: (1R)-1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride. InChIKey: JBLAOTNJWNXKOA-OGFXRTJISA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (1R)-1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride |
| InChIKey | JBLAOTNJWNXKOA-OGFXRTJISA-N |
| SMILES | CC1=C(C=C(C=C1)[C@@H](C)N)F.Cl |
Computed by PubChem (NCBI)