CAS 1820570-24-8 appears in our catalog under these names: (1R)-1-(3-fluoro-4-methylphenyl)ethan-1-amine hydrochloride, 95%, (1R)-1-(3-Fluoro-4-methylphenyl)ethan-1-amine hydrochloride, (1R)-1-(3-Fluoro-4-methylphenyl)ethan-1-amine hydrochloride 95+%, (1R)-1-(3-Fluoro-4-methylphenyl)ethan-1-amine hydrochloride, 95+%, 95+%, (1R)-1-(3-Fluoro-4-methylphenyl)ethan-1-amine hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 2,5g, 500mg, 2.5g, 5g.
(1R)-1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride (CAS 1820570-24-8) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: (1R)-1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride. InChIKey: JBLAOTNJWNXKOA-OGFXRTJISA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (1R)-1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride |
| InChIKey | JBLAOTNJWNXKOA-OGFXRTJISA-N |
| SMILES | CC1=C(C=C(C=C1)[C@@H](C)N)F.Cl |
Computed by PubChem (NCBI)