CAS 1486470-12-5 appears in our catalog under these names: (1S,2S)–2–((tert–Butoxycarbonyl)amino)cyclopropanecarboxylic acid, (1S,2S)-2-((tert-Butoxycarbonyl)amino)cyclopropanecarboxylic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 25mg, 0,5g, 50mg.
Trans-(1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid (CAS 1486470-12-5) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: trans-(1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid. InChIKey: NOZMNADEEKQWGO-WDSKDSINSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | trans-(1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid |
| InChIKey | NOZMNADEEKQWGO-WDSKDSINSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)