CAS 1415964-02-1 is the registry number for (1S,2R)-2-((tert-Butoxycarbonyl)amino)cyclopropanecarboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 10g.
Cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid (CAS 1415964-02-1) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid. InChIKey: NOZMNADEEKQWGO-NTSWFWBYSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | cis-(1S,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylic acid |
| InChIKey | NOZMNADEEKQWGO-NTSWFWBYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)