cas: 233661-54-6 — see every product listed under this CAS number, including other names
(1R,2R)-2-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, 97%, 97% (CAS 233661-54-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BBZ9-25g |
| cas | 233661-54-6 |
| size | 25g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 5589.20 Pln | |
| Chemat | 50g | 10389.20 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 957.20 Pln | |
| Chemat | 5g | 3371.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 233661-54-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: QJEQJDJFJWWURK-RKDXNWHRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | QJEQJDJFJWWURK-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)