(1R,2R)-Boc-aminocyclohexane carboxylic acid 97%
cas: 233661-54-6 — see every product listed under this CAS number, including other names
(1R,2R)-Boc-aminocyclohexane carboxylic acid 97% (CAS 233661-54-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1167939-100mg |
| cas | 233661-54-6 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 503.88 Pln | |
| Ambeed | 1g | 1249.25 Pln | |
| Ambeed | 5g | 4681.31 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1167939 |
Trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (CAS 233661-54-6) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid. InChIKey: QJEQJDJFJWWURK-RKDXNWHRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | trans-(1R,2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| InChIKey | QJEQJDJFJWWURK-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(1R,2R)-2-((tert-butoxycarbonyl)amino)cyclohexane-1-carboxylic acid, rac-(1R,2R)-2-(((tert-butoxy)carbonyl)amino)cyclohexane-1-carboxylic acid, rac-(1R,2R)-2-{[(tert-butoxy)carbonyl]amino}cyclohexane-1-carboxylic acid, trans-2-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, Boc-1,2-trans-ACHC-OH, (1R,2R)-2-((tert-Butoxycarbonyl)amino)cyclohexanecarboxylic acid, (1R,2R)-Boc-aminocyclohexane carboxylic acid, (1R,2R)-2-tert-Butoxycarbonylamino-cyclohexanecarboxylic acid, (1R,2R)-Boc-2-aminocyclohexane carboxylic acid, (1R,2R)-2-{[(tert-butoxy)carbonyl]amino}cyclohexane-1-carboxylic acid