(1R,2S)-2-Aminocyclohexanecarboxylic acid hydrochloride, 97%
cas: 158414-48-3 — see every product listed under this CAS number, including other names
(1R,2S)-2-Aminocyclohexanecarboxylic acid hydrochloride, 97% (CAS 158414-48-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg, 500mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A317754-250mg |
| cas | 158414-48-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 576.19 Pln | |
| Ambeed | 1g | 1471.75 Pln | |
| Chemat | 50mg | 462.80 Pln | |
| Chemat | 100mg | 539.60 Pln | |
| Chemat | 250mg | 1019.60 Pln | |
| Chemat | 500mg | 1970.00 Pln | |
| Chemat | 1g | 2718.80 Pln | |
| BLDpharm | 50mg | 308.80 Pln | |
| BLDpharm | 100mg | 458.75 Pln | |
| BLDpharm | 250mg | 619.81 Pln | |
| BLDpharm | 1g | 1580.58 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrochloride (CAS 158414-48-3) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrochloride. InChIKey: QNIOBHOEZYKCJV-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | QNIOBHOEZYKCJV-IBTYICNHSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(1R,2S)-2-aminocyclohexane-1-carboxylic Acid Hydrochloride, (1R,2S)-2-Aminocyclohexanecarboxylic acid hydrochloride, cis-2-Aminocyclohexanecarboxylic acid hydrochloride, (1R,2S)-(-)-2-Aminocyclohexanecarboxylic acid hydrochloride, cis-2-Amino-1-cyclohexanecarboxylic acid hydrochloride, (1R,2S)-2-aminocyclohexanecarboxylic acid;hydrochloride, (1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrochloride, cis-2-aminocyclohexane-1-carboxylic acid hcl, (1R,2S)-2-Aminocyclohexanecarboxylic acid HCl, cis-2-Aminocyclohexane-COOH*HCl