CAS 57266-57-6 appears in our catalog under these names: Trans-2-amino-cyclohexanecarboxylic acid hydrochloride, 95%, trans–2–Aminocyclohexanecarboxylic acid hydrochloride, 2-Aminocyclohexane-1-carboxylic acid hydrochloride, TRANS-2-AMINO-CYCLOHEXANECARBOXYLIC ACID HYDROCHLORIDE, 95%, 95%, trans-2-Aminocyclohexanecarboxylic acid hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 0,5g, 50mg.
Trans-(1R,2R)-2-aminocyclohexane-1-carboxylic acid;hydrochloride (CAS 57266-57-6) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: trans-(1R,2R)-2-aminocyclohexane-1-carboxylic acid;hydrochloride. InChIKey: QNIOBHOEZYKCJV-KGZKBUQUSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | trans-(1R,2R)-2-aminocyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | QNIOBHOEZYKCJV-KGZKBUQUSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)O)N.Cl |
Computed by PubChem (NCBI)