CAS 158414-45-0 appears in our catalog under these names: (1S,2R)-2-Aminocyclohexanecarboxylic acid hydrochloride, 95%, (+/-)-cis-2-Aminocyclohexane-1-carboxylic acid hydrochloride, (1S,2R)-2-Aminocyclohexanecarboxylic acid hydrochloride, 97%, 97%, (1S,2R)-2-Aminocyclohexanecarboxylic acid hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 500mg.
Cis-(1S,2R)-2-aminocyclohexane-1-carboxylic acid;hydrochloride (CAS 158414-45-0) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-(1S,2R)-2-aminocyclohexane-1-carboxylic acid;hydrochloride. InChIKey: QNIOBHOEZYKCJV-RIHPBJNCSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-(1S,2R)-2-aminocyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | QNIOBHOEZYKCJV-RIHPBJNCSA-N |
| SMILES | C1CC[C@H]([C@H](C1)C(=O)O)N.Cl |
Computed by PubChem (NCBI)