CAS 158414-48-3 appears in our catalog under these names: (1R,2S)-2-Aminocyclohexanecarboxylic acid hydrochloride, 95%, (1R,2S)-2-Aminocyclohexane-1-carboxylic acid hydrochloride, (1R,2S)-2-Aminocyclohexanecarboxylic acid hydrochloride, 97%, 97%, (1R,2S)-2-Aminocyclohexane-1-carboxylic acid hydrochloride, 97%, (1R,2S)-2-Aminocyclohexanecarboxylic acid hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 2,5g, 50mg, 100mg.
Cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrochloride (CAS 158414-48-3) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrochloride. InChIKey: QNIOBHOEZYKCJV-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-(1R,2S)-2-aminocyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | QNIOBHOEZYKCJV-IBTYICNHSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)C(=O)O)N.Cl |
Computed by PubChem (NCBI)