(1R,2S)-rel-2-Aminocyclopentanecarboxylic acid hydrochloride, 95%
cas: 18414-30-7 — see every product listed under this CAS number, including other names
(1R,2S)-rel-2-Aminocyclopentanecarboxylic acid hydrochloride, 95% (CAS 18414-30-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A736860-100mg |
| cas | 18414-30-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 448.25 Pln | |
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 1277.06 Pln | |
| Ambeed | 5g | 4787.00 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| BLDpharm | 100mg | 475.41 Pln | |
| BLDpharm | 250mg | 714.22 Pln | |
| BLDpharm | 1g | 1369.54 Pln | |
| BLDpharm | 5g | 5151.54 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Cis-(1R,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride (CAS 18414-30-7) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride. InChIKey: LVBDVNLIEHCCTP-JBUOLDKXSA-N.
| Molecular formula | C6H12ClNO2 |
|---|---|
| Molecular weight | 165.62 g/mol |
| IUPAC name | cis-(1R,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride |
| InChIKey | LVBDVNLIEHCCTP-JBUOLDKXSA-N |
| SMILES | C1C[C@H]([C@H](C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
cis-2-Amino-1-cyclopentanecarboxylic acid hydrochloride, (1R,2S)-2-aminocyclopentane-1-carboxylic Acid Hydrochloride, (1R,2S)-(-)-2-Amino-1-cyclopentanecarboxylic acid hydrochloride, cis-2-Amino-cyclopentanecarboxylic acid hydrochloride, (1R,2S)-2-Aminocyclopentanecarboxylic Acid Hydrochloride, cis-2-Aminocyclopentanecarboxylic acid hydrochloride, (1R,2S)-rel-2-Aminocyclopentanecarboxylic acid hydrochloride, cis-Pentacine HCl, (1R,2S)-2-aminocyclopentane-1-carboxylic acid;hydrochloride, (1R,2S)-2-aminocyclopentanecarboxylic acid hcl