Products 212755-84-5

CAS 212755-84-5 is the registry number for cis-2-Amino-1-cyclopentanecarboxylic acid hydrochloride hemihydrate, 99%. Offered by: Thermo Scientific (Acros). Available pack sizes: 250MG.

Structural formula: {0} (CAS {1})

2-aminocyclopentane-1-carboxylic acid;hydrochloride (CAS 212755-84-5) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: 2-aminocyclopentane-1-carboxylic acid;hydrochloride. InChIKey: LVBDVNLIEHCCTP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO2
Molecular weight165.62 g/mol
IUPAC name2-aminocyclopentane-1-carboxylic acid;hydrochloride
InChIKeyLVBDVNLIEHCCTP-UHFFFAOYSA-N
SMILESC1CC(C(C1)N)C(=O)O.Cl

Computed by PubChem (NCBI)