(1R,3S)-Methyl 3-aminocyclopentanecarboxylate hydrochloride 95%
cas: 180196-56-9 — see every product listed under this CAS number, including other names
(1R,3S)-Methyl 3-aminocyclopentanecarboxylate hydrochloride 95% (CAS 180196-56-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A205167-100mg |
| cas | 180196-56-9 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1310.44 Pln | |
| Ambeed | 25g | 3524.31 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A205167 |
Cis-methyl (1R,3S)-3-aminocyclopentane-1-carboxylate;hydrochloride (CAS 180196-56-9) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-methyl (1R,3S)-3-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: CKMCJNXERREXFB-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-methyl (1R,3S)-3-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | CKMCJNXERREXFB-IBTYICNHSA-N |
| SMILES | COC(=O)[C@@H]1CC[C@@H](C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
methyl (1R,3S)-3-aminocyclopentane-1-carboxylate hydrochloride, rac-methyl (1R,3S)-3-aminocyclopentane-1-carboxylate hydrochloride, Methyl cis-3-Aminocyclopentanecarboxylate Hydrochloride, cis-Methyl 3-aminocyclopentanecarboxylate hydrochloride, Methyl (1R,3S)-3-aminocyclopentane-1-carboxylate HCl, methyl (1R,3S)-3-aminocyclopentanecarboxylate hydrochloride, methyl (1R,3S)-3-aminocyclopentane-1-carboxylate;hydrochloride, methyl cis-3-aminocyclopentane-1-carboxylate hydrochloride, CKMCJNXERREXFB-IBTYICNHSA-N, (1R,3S)-Methyl-3