CAS 180323-49-3 appears in our catalog under these names: (1S,3R)–Methyl 3–aminocyclopentanecarboxylate hydrochloride, (1S,3R)-Methyl 3-aminocyclopentanecarboxylate hydrochloride, (1S,3R)-Methyl 3-aminocyclopentanecarboxylate hydrochloride, 96%, (1S,3R)-Methyl 3-aminocyclopentanecarboxylate hydrochloride 95%, methyl (1S,3R)-3-aminocyclopentane-1-carboxylate hydrochloride, 95%, 95%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
Cis-methyl (1S,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride (CAS 180323-49-3) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-methyl (1S,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: CKMCJNXERREXFB-RIHPBJNCSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-methyl (1S,3R)-3-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | CKMCJNXERREXFB-RIHPBJNCSA-N |
| SMILES | COC(=O)[C@H]1CC[C@H](C1)N.Cl |
Computed by PubChem (NCBI)