cas: 1415303-39-7 — see every product listed under this CAS number, including other names
(1S)-1-(4-tert-butylphenyl)ethan-1-amine hydrochloride, 95%, 95% (CAS 1415303-39-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12C2RU-10g |
| cas | 1415303-39-7 |
| size | 10g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 3568.40 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 602.00 Pln | |
| Chemat | 5g | 2253.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1S)-1-(4-tert-butylphenyl)ethanamine;hydrochloride (CAS 1415303-39-7) is a chemical compound with the molecular formula C12H20ClN and a molecular weight of 213.75 g/mol. IUPAC name: (1S)-1-(4-tert-butylphenyl)ethanamine;hydrochloride. InChIKey: WQCMEXXHUOHNLP-FVGYRXGTSA-N.
| Molecular formula | C12H20ClN |
|---|---|
| Molecular weight | 213.75 g/mol |
| IUPAC name | (1S)-1-(4-tert-butylphenyl)ethanamine;hydrochloride |
| InChIKey | WQCMEXXHUOHNLP-FVGYRXGTSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)C(C)(C)C)N.Cl |
Computed by PubChem (NCBI)