cas: 1415303-39-7 — see every product listed under this CAS number, including other names
(S)-1-(4-(tert-butyl)phenyl)ethan-1-amine hcl, 98% (CAS 1415303-39-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F695473-100MG |
| cas | 1415303-39-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 185.37 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 500mg | 414.46 Pln | |
| Fluorochem | 1g | 758.08 Pln | |
| Fluorochem | 2.5g | 1820.21 Pln | |
| Fluorochem | 5g | 2923.99 Pln | |
| Fluorochem | 10g | 5792.77 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1S)-1-(4-tert-butylphenyl)ethanamine;hydrochloride (CAS 1415303-39-7) is a chemical compound with the molecular formula C12H20ClN and a molecular weight of 213.75 g/mol. IUPAC name: (1S)-1-(4-tert-butylphenyl)ethanamine;hydrochloride. InChIKey: WQCMEXXHUOHNLP-FVGYRXGTSA-N.
| Molecular formula | C12H20ClN |
|---|---|
| Molecular weight | 213.75 g/mol |
| IUPAC name | (1S)-1-(4-tert-butylphenyl)ethanamine;hydrochloride |
| InChIKey | WQCMEXXHUOHNLP-FVGYRXGTSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)C(C)(C)C)N.Cl |
Computed by PubChem (NCBI)