(1S,2R)-Fmoc-Achc-OH 95%
cas: 430460-38-1 — see every product listed under this CAS number, including other names
(1S,2R)-Fmoc-Achc-OH 95% (CAS 430460-38-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A493014-100mg |
| cas | 430460-38-1 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 537.25 Pln | |
| Ambeed | 250mg | 1232.56 Pln | |
| Ambeed | 1g | 4670.19 Pln | |
| Ambeed | 5g | 16167.87 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A493014 |
Cis-(1S,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 430460-38-1) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: cis-(1S,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: NZMNDTGOODAUNI-AZUAARDMSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | cis-(1S,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | NZMNDTGOODAUNI-AZUAARDMSA-N |
| SMILES | C1CC[C@H]([C@H](C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
(1S,2R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)cyclohexanecarboxylic acid, (1S,2R)-Fmoc-aminocyclohexane carboxylic acid, (1S,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid, Fmoc-1,2-cis-ACHC-OH, N-Fmoc-(+/-)-cis-2-amino-cyclohexane-carboxylic acid, Fmoc-cis-2-aminocyclohexanecarboxylic acid, (1S,2R)-Fmoc-Achc, (1S,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexanecarboxylic acid, (1S,2R)-2-(Fmoc-amino)cyclohexanecarboxylic Acid, (1S,2R)-Fmoc-2-aminocyclohexane carboxylic acid, AldrichCPR