CAS 430460-38-1 appears in our catalog under these names: (1S,2R)-Fmoc-2-aminocyclohexane carboxylic acid, 95%, (1S,2R)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)cyclohexanecarboxylic acid, Fmoc-1,2-cis-ACHC-OH (1S,2R), (1S,2R)-Fmoc-aminocyclohexane carboxylic acid, (1S,2R)-Fmoc-Achc-OH 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 100mg, 1g, 5g, 250mg.
Cis-(1S,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 430460-38-1) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: cis-(1S,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: NZMNDTGOODAUNI-AZUAARDMSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | cis-(1S,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | NZMNDTGOODAUNI-AZUAARDMSA-N |
| SMILES | C1CC[C@H]([C@H](C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)